C20H18Cl4N2O3 — CID 59948072
3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-oxopentyl]-N-methylbenzamide (PubChem CID 59948072) has the molecular formula C20H18Cl4N2O3 and a molecular weight of 476.19 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-oxopentyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-oxopentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59948072 |
| Molecular Formula | C20H18Cl4N2O3 |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-oxopentyl]-N-methylbenzamide |
| SMILES | CO/N=C(\CN(C)C(=O)c1cc(Cl)cc(Cl)c1)C(CC=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl4N2O3/c1-26(20(28)13-7-14(21)10-15(22)8-13)11-19(25-29-2)16(5-6-27)12-3-4-17(23)18(24)9-12/h3-4,6-10,16H,5,11H2,1-2H3/b25-19+ |
| InChIKey | AMSYEIHPTWJTRT-NCELDCMTSA-N |
| XLogP | 5.75 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|