C6H7F6N — CID 59948137
1,1,1-trifluoro-N-(1,1,1-trifluoropropan-2-yl)propan-2-imine (PubChem CID 59948137) has the molecular formula C6H7F6N and a molecular weight of 207.12 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(1,1,1-trifluoropropan-2-yl)propan-2-imine.
| Compound Name | 1,1,1-trifluoro-N-(1,1,1-trifluoropropan-2-yl)propan-2-imine |
|---|---|
| PubChem CID | 59948137 |
| Molecular Formula | C6H7F6N |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1,1,1-trifluoro-N-(1,1,1-trifluoropropan-2-yl)propan-2-imine |
| SMILES | C/C(=N\C(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6N/c1-3(5(7,8)9)13-4(2)6(10,11)12/h3H,1-2H3/b13-4+ |
| InChIKey | DRYDOSJINXWNGE-YIXHJXPBSA-N |
| XLogP | 2.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|