About (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid
(6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid (PubChem CID 59949852) has the molecular formula C28H30FNO6
and a molecular weight of 495.55 g/mol. Its IUPAC name is (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid.
Molecular Properties
| Compound Name | (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid |
| PubChem CID | 59949852 |
| Molecular Formula | C28H30FNO6 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid |
| SMILES | O=C(O)C1O[C@H](COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1NF |
| InChI | InChI=1S/C28H30FNO6/c29-30-24-26(35-18-22-14-8-3-9-15-22)25(34-17-21-12-6-2-7-13-21)23(36-27(24)28(31)32)19-33-16-20-10-4-1-5-11-20/h1-15,23-27,30H,16-19H2,(H,31,32)/t23-,24?,25?,26?,27?/m1/s1 |
| InChIKey | FGWSCATWGAIIGZ-GWPQEICISA-N |
| XLogP | 4.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid?
The IUPAC name of (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid (CID 59949852) is (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid.
What is the SMILES notation for (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid?
The canonical SMILES for (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid is O=C(O)C1O[C@H](COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1NF.
What is the InChIKey of (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid?
The InChIKey is FGWSCATWGAIIGZ-GWPQEICISA-N. The full InChI is InChI=1S/C28H30FNO6/c29-30-24-26(35-18-22-14-8-3-9-15-22)25(34-17-21-12-6-2-7-13-21)23(36-27(24)28(31)32)19-33-16-20-10-4-1-5-11-20/h1-15,23-27,30H,16-19H2,(H,31,32)/t23-,24?,25?,26?,27?/m1/s1.
What are the key properties of (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid?
(6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid has a molecular weight of 495.55 g/mol, XLogP of 4.07, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid is sourced from PubChem (CID 59949852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).