C12H21NO — CID 59949976
(1R,2R,6R)-4-methyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene (PubChem CID 59949976) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (1R,2R,6R)-4-methyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene.
| Compound Name | (1R,2R,6R)-4-methyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 59949976 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (1R,2R,6R)-4-methyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H]2N[C@H]21 |
| InChI | InChI=1S/C12H21NO/c1-4-9(5-2)14-11-7-8(3)6-10-12(11)13-10/h7,9-13H,4-6H2,1-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | WQDVPOMCKJXMOI-IJLUTSLNSA-N |
| XLogP | 2.25 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|