C33H45F — CID 59950119
1-[2-[4-[(E)-3-fluoroprop-2-enyl]cyclohexyl]prop-1-enyl]-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene (PubChem CID 59950119) has the molecular formula C33H45F and a molecular weight of 460.72 g/mol. Its IUPAC name is 1-[2-[4-[(E)-3-fluoroprop-2-enyl]cyclohexyl]prop-1-enyl]-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene.
| Compound Name | 1-[2-[4-[(E)-3-fluoroprop-2-enyl]cyclohexyl]prop-1-enyl]-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene |
|---|---|
| PubChem CID | 59950119 |
| Molecular Formula | C33H45F |
| Molecular Weight | 460.72 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | 1-[2-[4-[(E)-3-fluoroprop-2-enyl]cyclohexyl]prop-1-enyl]-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene |
| SMILES | CC(=Cc1c(C)c(C)c(-c2c(C)c(C)c(C)c(C)c2C)c(C)c1C)C1CCC(C/C=C/F)CC1 |
| InChI | InChI=1S/C33H45F/c1-19(30-15-13-29(14-16-30)12-11-17-34)18-31-23(5)27(9)33(28(10)24(31)6)32-25(7)21(3)20(2)22(4)26(32)8/h11,17-18,29-30H,12-16H2,1-10H3/b17-11+,19-18? |
| InChIKey | RZPNVMIZSGJFGA-PYONUKAGSA-N |
| XLogP | 10.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.72 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |