C30H46F2 — CID 59950170
1-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2,3,4,5,6-pentamethylbenzene (PubChem CID 59950170) has the molecular formula C30H46F2 and a molecular weight of 444.69 g/mol. Its IUPAC name is 1-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 59950170 |
| Molecular Formula | C30H46F2 |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 1-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(C2CCC(CCCCC3CCC(CC=C(F)F)CC3)CC2)c(C)c1C |
| InChI | InChI=1S/C30H46F2/c1-20-21(2)23(4)30(24(5)22(20)3)28-17-14-26(15-18-28)9-7-6-8-25-10-12-27(13-11-25)16-19-29(31)32/h19,25-28H,6-18H2,1-5H3 |
| InChIKey | PRLZVGMHZUPONX-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|