C21H24N2O6 — CID 59950501
3-methyl-5-(10-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl)cyclohexane-1-carboxylic acid (PubChem CID 59950501) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-methyl-5-(10-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-5-(10-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 59950501 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-methyl-5-(10-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CC(N2C(=O)C3C4C=CC(C5C(=O)N(C)C(=O)C45)C3C2=O)C1 |
| InChI | InChI=1S/C21H24N2O6/c1-8-5-9(21(28)29)7-10(6-8)23-19(26)15-11-3-4-12(16(15)20(23)27)14-13(11)17(24)22(2)18(14)25/h3-4,8-16H,5-7H2,1-2H3,(H,28,29) |
| InChIKey | VIOOQLFKUKFEHT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|