About 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione
5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 59950825) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione |
| PubChem CID | 59950825 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCC(C)C1(C)SC(=O)NC1=O |
| InChI | InChI=1S/C11H19NO2S/c1-4-5-6-7-8(2)11(3)9(13)12-10(14)15-11/h8H,4-7H2,1-3H3,(H,12,13,14) |
| InChIKey | QPWSJEVMJVUEKI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione?
The IUPAC name of 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione (CID 59950825) is 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione?
The canonical SMILES for 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione is CCCCCC(C)C1(C)SC(=O)NC1=O.
What is the InChIKey of 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione?
The InChIKey is QPWSJEVMJVUEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-4-5-6-7-8(2)11(3)9(13)12-10(14)15-11/h8H,4-7H2,1-3H3,(H,12,13,14).
What are the key properties of 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione?
5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione has a molecular weight of 229.34 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptan-2-yl-5-methyl-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 59950825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).