C9H17N3O — CID 59950932
(3S)-3-amino-1-(C,N-dimethylcarbonimidoyl)azepan-2-one (PubChem CID 59950932) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (3S)-3-amino-1-(C,N-dimethylcarbonimidoyl)azepan-2-one.
| Compound Name | (3S)-3-amino-1-(C,N-dimethylcarbonimidoyl)azepan-2-one |
|---|---|
| PubChem CID | 59950932 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (3S)-3-amino-1-(C,N-dimethylcarbonimidoyl)azepan-2-one |
| SMILES | C/N=C(\C)N1CCCC[C@H](N)C1=O |
| InChI | InChI=1S/C9H17N3O/c1-7(11-2)12-6-4-3-5-8(10)9(12)13/h8H,3-6,10H2,1-2H3/b11-7+/t8-/m0/s1 |
| InChIKey | KBILBYFCZCOWLF-LBTPYSACSA-N |
| XLogP | 0.37 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|