C20H23O3PY — CID 59950969
(2,4,6-trimethylbenzoyl)phosphonoyl-(2,4,6-trimethylphenyl)methanone;yttrium (PubChem CID 59950969) has the molecular formula C20H23O3PY and a molecular weight of 431.28 g/mol. Its IUPAC name is (2,4,6-trimethylbenzoyl)phosphonoyl-(2,4,6-trimethylphenyl)methanone;yttrium.
| Compound Name | (2,4,6-trimethylbenzoyl)phosphonoyl-(2,4,6-trimethylphenyl)methanone;yttrium |
|---|---|
| PubChem CID | 59950969 |
| Molecular Formula | C20H23O3PY |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | (2,4,6-trimethylbenzoyl)phosphonoyl-(2,4,6-trimethylphenyl)methanone;yttrium |
| SMILES | Cc1cc(C)c(C(=O)[PH](=O)C(=O)c2c(C)cc(C)cc2C)c(C)c1.[Y] |
| InChI | InChI=1S/C20H23O3P.Y/c1-11-7-13(3)17(14(4)8-11)19(21)24(23)20(22)18-15(5)9-12(2)10-16(18)6;/h7-10,24H,1-6H3; |
| InChIKey | HVMRKDGBPYFUPK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|