C34H37N7O4S — CID 59951190
4-[1-(4-carbamoylphenyl)indazol-3-yl]-N-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propyl]benzamide (PubChem CID 59951190) has the molecular formula C34H37N7O4S and a molecular weight of 639.78 g/mol. Its IUPAC name is 4-[1-(4-carbamoylphenyl)indazol-3-yl]-N-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propyl]benzamide.
| Compound Name | 4-[1-(4-carbamoylphenyl)indazol-3-yl]-N-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 59951190 |
| Molecular Formula | C34H37N7O4S |
| Molecular Weight | 639.78 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 4-[1-(4-carbamoylphenyl)indazol-3-yl]-N-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propyl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nc(-c3ccc(C(=O)NCCCNC(=O)CCCCC4SCC5NC(=O)NC54)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H37N7O4S/c35-32(43)22-14-16-24(17-15-22)41-27-7-2-1-6-25(27)30(40-41)21-10-12-23(13-11-21)33(44)37-19-5-18-36-29(42)9-4-3-8-28-31-26(20-46-28)38-34(45)39-31/h1-2,6-7,10-17,26,28,31H,3-5,8-9,18-20H2,(H2,35,43)(H,36,42)(H,37,44)(H2,38,39,45) |
| InChIKey | HLBRBVYVSACYTA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|