C48H47N5O7S — CID 59951204
4-[1-[4-[[(2,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]carbamoyl]phenyl]indazol-3-yl]-N-[3-[(4-methylphenyl)sulfonylamino]propyl]benzamide (PubChem CID 59951204) has the molecular formula C48H47N5O7S and a molecular weight of 838.00 g/mol. Its IUPAC name is 4-[1-[4-[[(2,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]carbamoyl]phenyl]indazol-3-yl]-N-[3-[(4-methylphenyl)sulfonylamino]propyl]benzamide.
| Compound Name | 4-[1-[4-[[(2,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]carbamoyl]phenyl]indazol-3-yl]-N-[3-[(4-methylphenyl)sulfonylamino]propyl]benzamide |
|---|---|
| PubChem CID | 59951204 |
| Molecular Formula | C48H47N5O7S |
| Molecular Weight | 838.00 g/mol |
| Exact Mass | 837.32 |
| IUPAC Name | 4-[1-[4-[[(2,4-dimethoxyphenyl)-(4-ethoxyphenyl)methyl]carbamoyl]phenyl]indazol-3-yl]-N-[3-[(4-methylphenyl)sulfonylamino]propyl]benzamide |
| SMILES | CCOc1ccc(C(NC(=O)c2ccc(-n3nc(-c4ccc(C(=O)NCCCNS(=O)(=O)c5ccc(C)cc5)cc4)c4ccccc43)cc2)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C48H47N5O7S/c1-5-60-38-23-19-33(20-24-38)45(42-28-25-39(58-3)31-44(42)59-4)51-48(55)36-17-21-37(22-18-36)53-43-10-7-6-9-41(43)46(52-53)34-13-15-35(16-14-34)47(54)49-29-8-30-50-61(56,57)40-26-11-32(2)12-27-40/h6-7,9-28,31,45,50H,5,8,29-30H2,1-4H3,(H,49,54)(H,51,55) |
| InChIKey | KCKSQKBWRGRQAU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.00 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|