C8H11F3O — CID 59951353
(E)-1,1,1-trifluoro-2,2-dimethylhex-4-en-3-one (PubChem CID 59951353) has the molecular formula C8H11F3O and a molecular weight of 180.17 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-1,1,1-trifluoro-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 59951353 |
| Molecular Formula | C8H11F3O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (E)-1,1,1-trifluoro-2,2-dimethylhex-4-en-3-one |
| SMILES | C/C=C/C(=O)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O/c1-4-5-6(12)7(2,3)8(9,10)11/h4-5H,1-3H3/b5-4+ |
| InChIKey | VTCLUZHLFMWRHW-SNAWJCMRSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|