C22H26N2 — CID 59951485
2,5-dimethyl-8-[(Z)-2-phenylprop-1-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 59951485) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,5-dimethyl-8-[(Z)-2-phenylprop-1-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,5-dimethyl-8-[(Z)-2-phenylprop-1-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 59951485 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2,5-dimethyl-8-[(Z)-2-phenylprop-1-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | C/C(=C/c1ccc2c(c1)C1CN(C)CCC1N2C)c1ccccc1 |
| InChI | InChI=1S/C22H26N2/c1-16(18-7-5-4-6-8-18)13-17-9-10-21-19(14-17)20-15-23(2)12-11-22(20)24(21)3/h4-10,13-14,20,22H,11-12,15H2,1-3H3/b16-13- |
| InChIKey | XZESKMAYMPXKMI-SSZFMOIBSA-N |
| XLogP | 4.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|