C9H15NO2 — CID 59951938
(3aR,4R,6aR)-4-ethyl-5-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-2-one (PubChem CID 59951938) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-ethyl-5-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-2-one.
| Compound Name | (3aR,4R,6aR)-4-ethyl-5-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 59951938 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3aR,4R,6aR)-4-ethyl-5-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-2-one |
| SMILES | CC[C@@H]1[C@H]2CC(=O)O[C@H]2CN1C |
| InChI | InChI=1S/C9H15NO2/c1-3-7-6-4-9(11)12-8(6)5-10(7)2/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | BSMFSYIYIOSELN-PRJMDXOYSA-N |
| XLogP | 0.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |