C11H16N2O — CID 59952052
(1R,2R)-1,6-bis(methylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 59952052) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,2R)-1,6-bis(methylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2R)-1,6-bis(methylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 59952052 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (1R,2R)-1,6-bis(methylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | CNc1ccc2c(c1)[C@@H](NC)[C@H](O)C2 |
| InChI | InChI=1S/C11H16N2O/c1-12-8-4-3-7-5-10(14)11(13-2)9(7)6-8/h3-4,6,10-14H,5H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | QTKOADNCILWMBR-GHMZBOCLSA-N |
| XLogP | 0.91 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |