C27H40N3O+ — CID 59952330
methyl-[3,4,5-trimethyl-6-[1-methyl-5-oxo-4-[3,4,5-trimethyl-8-(methylamino)octa-3,5,7-trien-2-ylidene]pyrrolidin-2-ylidene]hexa-1,2,4-trienyl]azanium (PubChem CID 59952330) has the molecular formula C27H40N3O+ and a molecular weight of 422.64 g/mol. Its IUPAC name is methyl-[3,4,5-trimethyl-6-[1-methyl-5-oxo-4-[3,4,5-trimethyl-8-(methylamino)octa-3,5,7-trien-2-ylidene]pyrrolidin-2-ylidene]hexa-1,2,4-trienyl]azanium.
| Compound Name | methyl-[3,4,5-trimethyl-6-[1-methyl-5-oxo-4-[3,4,5-trimethyl-8-(methylamino)octa-3,5,7-trien-2-ylidene]pyrrolidin-2-ylidene]hexa-1,2,4-trienyl]azanium |
|---|---|
| PubChem CID | 59952330 |
| Molecular Formula | C27H40N3O+ |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | methyl-[3,4,5-trimethyl-6-[1-methyl-5-oxo-4-[3,4,5-trimethyl-8-(methylamino)octa-3,5,7-trien-2-ylidene]pyrrolidin-2-ylidene]hexa-1,2,4-trienyl]azanium |
| SMILES | CNC=CC=C(C)C(C)=C(C)C(C)=C1CC(=CC(C)=C(C)C(C)=C=C[NH2+]C)N(C)C1=O |
| InChI | InChI=1S/C27H39N3O/c1-18(12-11-14-28-8)22(5)23(6)24(7)26-17-25(30(10)27(26)31)16-20(3)21(4)19(2)13-15-29-9/h11-12,14-16,28-29H,17H2,1-10H3/p+1 |
| InChIKey | LPPBUJJWASBBOP-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|