C16H35Cl2NSiZr — CID 59952407
tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) (PubChem CID 59952407) has the molecular formula C16H35Cl2NSiZr and a molecular weight of 431.68 g/mol. Its IUPAC name is tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+).
| Compound Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 59952407 |
| Molecular Formula | C16H35Cl2NSiZr |
| Molecular Weight | 431.68 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) |
| SMILES | CC1C(C)C(C)C([Si](C)(C)[N-]C(C)(C)C)C1C.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C15H32NSi.CH3.2ClH.Zr/c1-10-11(2)13(4)14(12(10)3)17(8,9)16-15(5,6)7;;;;/h10-14H,1-9H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | ODCFNEXMPZMJPU-UHFFFAOYSA-L |
| XLogP | 7.12 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|