C14H17NO3 — CID 59952644
(7aS)-7-hydroxy-6,7a-dimethyl-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 59952644) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (7aS)-7-hydroxy-6,7a-dimethyl-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7aS)-7-hydroxy-6,7a-dimethyl-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 59952644 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (7aS)-7-hydroxy-6,7a-dimethyl-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1C(=O)N2C(c3ccccc3)OC[C@@]2(C)C1O |
| InChI | InChI=1S/C14H17NO3/c1-9-11(16)14(2)8-18-13(15(14)12(9)17)10-6-4-3-5-7-10/h3-7,9,11,13,16H,8H2,1-2H3/t9?,11?,13?,14-/m0/s1 |
| InChIKey | DBBIVTRZZZWPOZ-DASMHPDHSA-N |
| XLogP | 1.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |