C23H23N5O6 — CID 59952929
(10R)-4-acetyl-8-[(E)-[1-[1-(2-amino-2-oxoethyl)pyridin-1-ium-3-yl]-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylate (PubChem CID 59952929) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is (10R)-4-acetyl-8-[(E)-[1-[1-(2-amino-2-oxoethyl)pyridin-1-ium-3-yl]-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylate.
| Compound Name | (10R)-4-acetyl-8-[(E)-[1-[1-(2-amino-2-oxoethyl)pyridin-1-ium-3-yl]-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylate |
|---|---|
| PubChem CID | 59952929 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (10R)-4-acetyl-8-[(E)-[1-[1-(2-amino-2-oxoethyl)pyridin-1-ium-3-yl]-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylate |
| SMILES | CC(=O)N1CC2CC(/C=C3\CCN(c4ccc[n+](CC(N)=O)c4)C3=O)=C(C(=O)[O-])N3C(=O)C1[C@@H]23 |
| InChI | InChI=1S/C23H23N5O6/c1-12(29)27-9-15-8-14(19(23(33)34)28-18(15)20(27)22(28)32)7-13-4-6-26(21(13)31)16-3-2-5-25(10-16)11-17(24)30/h2-3,5,7,10,15,18,20H,4,6,8-9,11H2,1H3,(H2-,24,30,33,34)/b13-7+/t15?,18-,20?/m1/s1 |
| InChIKey | PXYUNNNCNWULRH-HNBVLVMWSA-N |
| XLogP | -2.41 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|