C24H22F3N5O6 — CID 59952965
(10R)-4-[(4-carbamoylphenyl)carbamoyl]-2-oxo-8-[(E)-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-ylidene]methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid (PubChem CID 59952965) has the molecular formula C24H22F3N5O6 and a molecular weight of 533.46 g/mol. Its IUPAC name is (10R)-4-[(4-carbamoylphenyl)carbamoyl]-2-oxo-8-[(E)-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-ylidene]methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid.
| Compound Name | (10R)-4-[(4-carbamoylphenyl)carbamoyl]-2-oxo-8-[(E)-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-ylidene]methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 59952965 |
| Molecular Formula | C24H22F3N5O6 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (10R)-4-[(4-carbamoylphenyl)carbamoyl]-2-oxo-8-[(E)-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-ylidene]methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
| SMILES | NC(=O)c1ccc(NC(=O)N2CC3CC(/C=C4\CCN(CC(F)(F)F)C4=O)=C(C(=O)O)N4C(=O)C2[C@@H]34)cc1 |
| InChI | InChI=1S/C24H22F3N5O6/c25-24(26,27)10-30-6-5-12(20(30)34)7-13-8-14-9-31(18-16(14)32(21(18)35)17(13)22(36)37)23(38)29-15-3-1-11(2-4-15)19(28)33/h1-4,7,14,16,18H,5-6,8-10H2,(H2,28,33)(H,29,38)(H,36,37)/b12-7+/t14?,16-,18?/m1/s1 |
| InChIKey | JRYIODXCZTYXCP-IFWZHMPASA-N |
| XLogP | 1.29 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|