C11H24N2O2 — CID 59953228
(2R)-1-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-2-methyl-3-(methylamino)propan-1-ol (PubChem CID 59953228) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R)-1-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-2-methyl-3-(methylamino)propan-1-ol.
| Compound Name | (2R)-1-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-2-methyl-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 59953228 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (2R)-1-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-2-methyl-3-(methylamino)propan-1-ol |
| SMILES | CNC[C@@H](C)C(O)[C@@H]1CC(OC)CN1C |
| InChI | InChI=1S/C11H24N2O2/c1-8(6-12-2)11(14)10-5-9(15-4)7-13(10)3/h8-12,14H,5-7H2,1-4H3/t8-,9?,10+,11?/m1/s1 |
| InChIKey | CTRXHQGJAZYAPG-VKAADOFISA-N |
| XLogP | -0.08 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |