C11H21NO3 — CID 59953235
(3S)-4-hydroxy-4-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-3-methylbutan-2-one (PubChem CID 59953235) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (3S)-4-hydroxy-4-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-hydroxy-4-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 59953235 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3S)-4-hydroxy-4-[(2S)-4-methoxy-1-methylpyrrolidin-2-yl]-3-methylbutan-2-one |
| SMILES | COC1C[C@@H](C(O)[C@H](C)C(C)=O)N(C)C1 |
| InChI | InChI=1S/C11H21NO3/c1-7(8(2)13)11(14)10-5-9(15-4)6-12(10)3/h7,9-11,14H,5-6H2,1-4H3/t7-,9?,10+,11?/m1/s1 |
| InChIKey | LNPXERONYKPFSH-YJVKZPBASA-N |
| XLogP | 0.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |