C38H34N4O5S — CID 59953304
3-[2-[(Z)-(3-butyl-5-indol-1-yl-1,3-benzoxazol-2-ylidene)methyl]-5-indol-1-yl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 59953304) has the molecular formula C38H34N4O5S and a molecular weight of 658.78 g/mol. Its IUPAC name is 3-[2-[(Z)-(3-butyl-5-indol-1-yl-1,3-benzoxazol-2-ylidene)methyl]-5-indol-1-yl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(Z)-(3-butyl-5-indol-1-yl-1,3-benzoxazol-2-ylidene)methyl]-5-indol-1-yl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59953304 |
| Molecular Formula | C38H34N4O5S |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | 3-[2-[(Z)-(3-butyl-5-indol-1-yl-1,3-benzoxazol-2-ylidene)methyl]-5-indol-1-yl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CCCCN1/C(=C/c2oc3ccc(-n4ccc5ccccc54)cc3[n+]2CCCS(=O)(=O)[O-])Oc2ccc(-n3ccc4ccccc43)cc21 |
| InChI | InChI=1S/C38H34N4O5S/c1-2-3-19-41-33-24-29(39-21-17-27-9-4-6-11-31(27)39)13-15-35(33)46-37(41)26-38-42(20-8-23-48(43,44)45)34-25-30(14-16-36(34)47-38)40-22-18-28-10-5-7-12-32(28)40/h4-7,9-18,21-22,24-26H,2-3,8,19-20,23H2,1H3 |
| InChIKey | WRPBKWFYGVHRRX-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 96.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|