C25H38N2O7S — CID 59954279
3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-5-(3-methylbutylsulfanyl)-4-oxopentanoic acid (PubChem CID 59954279) has the molecular formula C25H38N2O7S and a molecular weight of 510.65 g/mol. Its IUPAC name is 3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-5-(3-methylbutylsulfanyl)-4-oxopentanoic acid.
| Compound Name | 3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-5-(3-methylbutylsulfanyl)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 59954279 |
| Molecular Formula | C25H38N2O7S |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-5-(3-methylbutylsulfanyl)-4-oxopentanoic acid |
| SMILES | COc1ccc(OC)c(CC(=O)N[C@H](C(=O)NC(CC(=O)O)C(=O)CSCCC(C)C)C(C)C)c1 |
| InChI | InChI=1S/C25H38N2O7S/c1-15(2)9-10-35-14-20(28)19(13-23(30)31)26-25(32)24(16(3)4)27-22(29)12-17-11-18(33-5)7-8-21(17)34-6/h7-8,11,15-16,19,24H,9-10,12-14H2,1-6H3,(H,26,32)(H,27,29)(H,30,31)/t19?,24-/m0/s1 |
| InChIKey | FZMUIZSEVONMLS-WIIYFNMSSA-N |
| XLogP | 2.69 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|