About benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium
benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium (PubChem CID 59954316) has the molecular formula C14H21N3Y-2
and a molecular weight of 320.25 g/mol. Its IUPAC name is benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium.
Molecular Properties
| Compound Name | benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium |
| PubChem CID | 59954316 |
| Molecular Formula | C14H21N3Y-2 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium |
| SMILES | [CH2-]N1CCN(/C(C)=N/C)CC1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C8H16N3.C6H5.Y/c1-8(9-2)11-6-4-10(3)5-7-11;1-2-4-6-5-3-1;/h3-7H2,1-2H3;1-5H;/q2*-1;/b9-8+;; |
| InChIKey | DNXMKSLWCJAFCO-YEUQMBKVSA-N |
| XLogP | 1.93 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium?
The IUPAC name of benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium (CID 59954316) is benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium.
What is the SMILES notation for benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium?
The canonical SMILES for benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium is [CH2-]N1CCN(/C(C)=N/C)CC1.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium?
The InChIKey is DNXMKSLWCJAFCO-YEUQMBKVSA-N. The full InChI is InChI=1S/C8H16N3.C6H5.Y/c1-8(9-2)11-6-4-10(3)5-7-11;1-2-4-6-5-3-1;/h3-7H2,1-2H3;1-5H;/q2*-1;/b9-8+;;.
What are the key properties of benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium?
benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium has a molecular weight of 320.25 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-(4-methanidylpiperazin-1-yl)-N-methylethanimine;yttrium is sourced from PubChem (CID 59954316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).