C25H31AcNO4S — CID 59954383
actinium;methyl (Z)-7-[(1S,2S,4R)-3-[(5-hydroxy-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]-6-methylhept-5-enoate (PubChem CID 59954383) has the molecular formula C25H31AcNO4S and a molecular weight of 668.59 g/mol. Its IUPAC name is actinium;methyl (Z)-7-[(1S,2S,4R)-3-[(5-hydroxy-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]-6-methylhept-5-enoate.
| Compound Name | actinium;methyl (Z)-7-[(1S,2S,4R)-3-[(5-hydroxy-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 59954383 |
| Molecular Formula | C25H31AcNO4S |
| Molecular Weight | 668.59 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | actinium;methyl (Z)-7-[(1S,2S,4R)-3-[(5-hydroxy-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]-6-methylhept-5-enoate |
| SMILES | COC(=O)CCC/C=C(/C)C[C@@H]1C(NC(=O)c2csc3ccc(O)cc23)[C@@H]2CC[C@H]1C2.[Ac] |
| InChI | InChI=1S/C25H31NO4S.Ac/c1-15(5-3-4-6-23(28)30-2)11-19-16-7-8-17(12-16)24(19)26-25(29)21-14-31-22-10-9-18(27)13-20(21)22;/h5,9-10,13-14,16-17,19,24,27H,3-4,6-8,11-12H2,1-2H3,(H,26,29);/b15-5-;/t16-,17+,19-,24?;/m0./s1 |
| InChIKey | ODJZDHVPXNFKHX-KVPWWRSASA-N |
| XLogP | 5.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|