About cis-(1R,2R)-1-ethyl-2-methylcyclopropane
cis-(1R,2R)-1-ethyl-2-methylcyclopropane (PubChem CID 59954461) has the molecular formula C6H12
and a molecular weight of 84.16 g/mol. Its IUPAC name is cis-(1R,2R)-1-ethyl-2-methylcyclopropane.
Molecular Properties
| Compound Name | cis-(1R,2R)-1-ethyl-2-methylcyclopropane |
| PubChem CID | 59954461 |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 g/mol |
| Exact Mass | 84.09 |
| IUPAC Name | cis-(1R,2R)-1-ethyl-2-methylcyclopropane |
| SMILES | CC[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C6H12/c1-3-6-4-5(6)2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | SAHWBARCQUAFSM-PHDIDXHHSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cis-(1R,2R)-1-ethyl-2-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-1-ethyl-2-methylcyclopropane?
The IUPAC name of cis-(1R,2R)-1-ethyl-2-methylcyclopropane (CID 59954461) is cis-(1R,2R)-1-ethyl-2-methylcyclopropane.
What is the SMILES notation for cis-(1R,2R)-1-ethyl-2-methylcyclopropane?
The canonical SMILES for cis-(1R,2R)-1-ethyl-2-methylcyclopropane is CC[C@@H]1C[C@H]1C.
What is the InChIKey of cis-(1R,2R)-1-ethyl-2-methylcyclopropane?
The InChIKey is SAHWBARCQUAFSM-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H12/c1-3-6-4-5(6)2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of cis-(1R,2R)-1-ethyl-2-methylcyclopropane?
cis-(1R,2R)-1-ethyl-2-methylcyclopropane has a molecular weight of 84.16 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-1-ethyl-2-methylcyclopropane is sourced from PubChem (CID 59954461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).