About N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium
N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium (PubChem CID 59954524) has the molecular formula C10H17NO2U2
and a molecular weight of 659.31 g/mol. Its IUPAC name is N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium.
Molecular Properties
| Compound Name | N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium |
| PubChem CID | 59954524 |
| Molecular Formula | C10H17NO2U2 |
| Molecular Weight | 659.31 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium |
| SMILES | CC(=O)NC1C(O)C=C(C)C[C@@H]1C.[U].[U] |
| InChI | InChI=1S/C10H17NO2.2U/c1-6-4-7(2)10(9(13)5-6)11-8(3)12;;/h5,7,9-10,13H,4H2,1-3H3,(H,11,12);;/t7-,9?,10?;;/m0../s1 |
| InChIKey | OJQJAXJRKXCUOQ-YNBYCUSSSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 659.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium?
The IUPAC name of N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium (CID 59954524) is N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium.
What is the SMILES notation for N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium?
The canonical SMILES for N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium is CC(=O)NC1C(O)C=C(C)C[C@@H]1C.[U].[U].
What is the InChIKey of N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium?
The InChIKey is OJQJAXJRKXCUOQ-YNBYCUSSSA-N. The full InChI is InChI=1S/C10H17NO2.2U/c1-6-4-7(2)10(9(13)5-6)11-8(3)12;;/h5,7,9-10,13H,4H2,1-3H3,(H,11,12);;/t7-,9?,10?;;/m0../s1.
What are the key properties of N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium?
N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium has a molecular weight of 659.31 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6S)-2-hydroxy-4,6-dimethylcyclohex-3-en-1-yl]acetamide;uranium is sourced from PubChem (CID 59954524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).