C9H15NO — CID 59954528
(1R,5R,6R)-5-methoxy-3,7-dimethyl-7-azabicyclo[4.1.0]hept-2-ene (PubChem CID 59954528) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (1R,5R,6R)-5-methoxy-3,7-dimethyl-7-azabicyclo[4.1.0]hept-2-ene.
| Compound Name | (1R,5R,6R)-5-methoxy-3,7-dimethyl-7-azabicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 59954528 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1R,5R,6R)-5-methoxy-3,7-dimethyl-7-azabicyclo[4.1.0]hept-2-ene |
| SMILES | CO[C@@H]1CC(C)=C[C@@H]2[C@H]1N2C |
| InChI | InChI=1S/C9H15NO/c1-6-4-7-9(10(7)2)8(5-6)11-3/h4,7-9H,5H2,1-3H3/t7-,8-,9-,10?/m1/s1 |
| InChIKey | MBLKFBUDHWPQKQ-PBVVMKELSA-N |
| XLogP | 1.03 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|