C17H26O3 — CID 59954548
(1aR,2S,4aR,8aR)-2-tert-butyl-2-hydroxy-4a-methyl-8-methylidene-1a,3,4,5,6,7-hexahydronaphtho[1,8a-b]oxirene-7-carbaldehyde (PubChem CID 59954548) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1aR,2S,4aR,8aR)-2-tert-butyl-2-hydroxy-4a-methyl-8-methylidene-1a,3,4,5,6,7-hexahydronaphtho[1,8a-b]oxirene-7-carbaldehyde.
| Compound Name | (1aR,2S,4aR,8aR)-2-tert-butyl-2-hydroxy-4a-methyl-8-methylidene-1a,3,4,5,6,7-hexahydronaphtho[1,8a-b]oxirene-7-carbaldehyde |
|---|---|
| PubChem CID | 59954548 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1aR,2S,4aR,8aR)-2-tert-butyl-2-hydroxy-4a-methyl-8-methylidene-1a,3,4,5,6,7-hexahydronaphtho[1,8a-b]oxirene-7-carbaldehyde |
| SMILES | C=C1C(C=O)CC[C@]2(C)CC[C@](O)(C(C)(C)C)[C@H]3O[C@]132 |
| InChI | InChI=1S/C17H26O3/c1-11-12(10-18)6-7-15(5)8-9-16(19,14(2,3)4)13-17(11,15)20-13/h10,12-13,19H,1,6-9H2,2-5H3/t12?,13-,15-,16-,17-/m1/s1 |
| InChIKey | CHLCRPKWWZNXLQ-UJYGPIMOSA-N |
| XLogP | 2.87 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|