C30H49NO3 — CID 59954601
[(5bR,9E,11aR)-9-hydroxyimino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]oxymethanol (PubChem CID 59954601) has the molecular formula C30H49NO3 and a molecular weight of 471.73 g/mol. Its IUPAC name is [(5bR,9E,11aR)-9-hydroxyimino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]oxymethanol.
| Compound Name | [(5bR,9E,11aR)-9-hydroxyimino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]oxymethanol |
|---|---|
| PubChem CID | 59954601 |
| Molecular Formula | C30H49NO3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | [(5bR,9E,11aR)-9-hydroxyimino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]oxymethanol |
| SMILES | C=C(C)C1CCC2(OCO)CCC3(C)C(CCC4[C@@]5(C)CC/C(=N\O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C30H49NO3/c1-19(2)20-10-15-30(34-18-32)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(31-33)26(3,4)22(27)11-14-29(23,28)7/h20-23,25,32-33H,1,8-18H2,2-7H3/b31-24+/t20?,21?,22?,23?,25?,27-,28?,29+,30?/m0/s1 |
| InChIKey | PHZHHNISERZRLJ-LSBRFLQSSA-N |
| XLogP | 7.19 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|