C29H50O4 — CID 59954617
(5bR,11aR)-1-(1-hydroxyethyl)-3a-(hydroxymethoxy)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 59954617) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is (5bR,11aR)-1-(1-hydroxyethyl)-3a-(hydroxymethoxy)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | (5bR,11aR)-1-(1-hydroxyethyl)-3a-(hydroxymethoxy)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 59954617 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (5bR,11aR)-1-(1-hydroxyethyl)-3a-(hydroxymethoxy)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | CC(O)C1CCC2(OCO)CCC3(C)C(CCC4[C@@]5(C)CCC(O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C29H50O4/c1-18(31)19-9-14-29(33-17-30)16-15-27(5)20(24(19)29)7-8-22-26(4)12-11-23(32)25(2,3)21(26)10-13-28(22,27)6/h18-24,30-32H,7-17H2,1-6H3/t18?,19?,20?,21?,22?,23?,24?,26-,27?,28+,29?/m0/s1 |
| InChIKey | BKCLLLGKLLANQU-UNELZEMASA-N |
| XLogP | 5.53 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|