C37H58O3 — CID 59954636
(5bR,11aR)-9-(3-ethylpent-1-yn-3-yl)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid (PubChem CID 59954636) has the molecular formula C37H58O3 and a molecular weight of 550.87 g/mol. Its IUPAC name is (5bR,11aR)-9-(3-ethylpent-1-yn-3-yl)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid.
| Compound Name | (5bR,11aR)-9-(3-ethylpent-1-yn-3-yl)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid |
|---|---|
| PubChem CID | 59954636 |
| Molecular Formula | C37H58O3 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.44 |
| IUPAC Name | (5bR,11aR)-9-(3-ethylpent-1-yn-3-yl)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | C#CC(CC)(CC)C1(O)CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4C(C(=C)C)CCC4(C(=O)O)CCC23C)C1(C)C |
| InChI | InChI=1S/C37H58O3/c1-11-35(12-2,13-3)37(40)23-20-32(8)27(31(37,6)7)17-18-34(10)28(32)15-14-26-29-25(24(4)5)16-19-36(29,30(38)39)22-21-33(26,34)9/h1,25-29,40H,4,12-23H2,2-3,5-10H3,(H,38,39)/t25?,26?,27?,28?,29?,32-,33?,34+,36?,37?/m0/s1 |
| InChIKey | QVJHXKMGTAEIEG-RNPHHOHHSA-N |
| XLogP | 8.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|