C11H15O2Y- — CID 59954685
1-[(4aS,7aR)-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-id-4-yl]ethanone;yttrium (PubChem CID 59954685) has the molecular formula C11H15O2Y- and a molecular weight of 268.14 g/mol. Its IUPAC name is 1-[(4aS,7aR)-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-id-4-yl]ethanone;yttrium.
| Compound Name | 1-[(4aS,7aR)-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-id-4-yl]ethanone;yttrium |
|---|---|
| PubChem CID | 59954685 |
| Molecular Formula | C11H15O2Y- |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-[(4aS,7aR)-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-id-4-yl]ethanone;yttrium |
| SMILES | CC(=O)C1=CO[CH-][C@@H]2C(C)CC[C@H]12.[Y] |
| InChI | InChI=1S/C11H15O2.Y/c1-7-3-4-9-10(7)5-13-6-11(9)8(2)12;/h5-7,9-10H,3-4H2,1-2H3;/q-1;/t7?,9-,10+;/m0./s1 |
| InChIKey | OEVOQONCFBVAGU-FZLMXZNUSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|