C21H22Br2N2O — CID 59954892
[4-[(2S)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-tritiomethanone (PubChem CID 59954892) has the molecular formula C21H22Br2N2O and a molecular weight of 480.24 g/mol. Its IUPAC name is [4-[(2S)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-tritiomethanone.
| Compound Name | [4-[(2S)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-tritiomethanone |
|---|---|
| PubChem CID | 59954892 |
| Molecular Formula | C21H22Br2N2O |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | [4-[(2S)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-tritiomethanone |
| SMILES | [3H]C(=O)N1CCC([C@@H]2c3ncc(Br)cc3CCc3cc(C)cc(Br)c32)CC1 |
| InChI | InChI=1S/C21H22Br2N2O/c1-13-8-15-2-3-16-10-17(22)11-24-21(16)20(19(15)18(23)9-13)14-4-6-25(12-26)7-5-14/h8-12,14,20H,2-7H2,1H3/t20-/m0/s1/i12T |
| InChIKey | QDGJFBZRININBM-PAKGBMJJSA-N |
| XLogP | 5.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|