About 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium
8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium (PubChem CID 59955603) has the molecular formula C16H21O2Y-
and a molecular weight of 334.25 g/mol. Its IUPAC name is 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium.
Molecular Properties
| Compound Name | 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium |
| PubChem CID | 59955603 |
| Molecular Formula | C16H21O2Y- |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium |
| SMILES | Cc1[c-]c(C)cc(C2CCC3(CC2)OCCO3)c1.[Y] |
| InChI | InChI=1S/C16H21O2.Y/c1-12-9-13(2)11-15(10-12)14-3-5-16(6-4-14)17-7-8-18-16;/h10-11,14H,3-8H2,1-2H3;/q-1; |
| InChIKey | JVDDXHYVHKUUIM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium?
The IUPAC name of 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium (CID 59955603) is 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium.
What is the SMILES notation for 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium?
The canonical SMILES for 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium is Cc1[c-]c(C)cc(C2CCC3(CC2)OCCO3)c1.[Y].
What is the InChIKey of 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium?
The InChIKey is JVDDXHYVHKUUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21O2.Y/c1-12-9-13(2)11-15(10-12)14-3-5-16(6-4-14)17-7-8-18-16;/h10-11,14H,3-8H2,1-2H3;/q-1;.
What are the key properties of 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium?
8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium has a molecular weight of 334.25 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,5-dimethylbenzene-4-id-1-yl)-1,4-dioxaspiro[4.5]decane;yttrium is sourced from PubChem (CID 59955603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).