About (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one
(5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 59955907) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 59955907 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2/OCCN2C)N(CC)C1=S |
| InChI | InChI=1S/C11H17N3O2S/c1-4-13-8(10-12(3)6-7-16-10)9(15)14(5-2)11(13)17/h4-7H2,1-3H3/b10-8- |
| InChIKey | DCJJMVGIXIZNNO-NTMALXAHSA-N |
| XLogP | 0.59 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one (CID 59955907) is (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one is CCN1C(=O)/C(=C2/OCCN2C)N(CC)C1=S.
What is the InChIKey of (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one?
The InChIKey is DCJJMVGIXIZNNO-NTMALXAHSA-N. The full InChI is InChI=1S/C11H17N3O2S/c1-4-13-8(10-12(3)6-7-16-10)9(15)14(5-2)11(13)17/h4-7H2,1-3H3/b10-8-.
What are the key properties of (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one?
(5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one has a molecular weight of 255.34 g/mol, XLogP of 0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-1,3-diethyl-5-(3-methyl-1,3-oxazolidin-2-ylidene)-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 59955907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).