C36H31N5O6 — CID 59956083
(5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-[2-(hydroperoxymethyl)phenyl]-7-[4-(hydroperoxymethyl)phenyl]-4-pyridin-2-ylpyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 59956083) has the molecular formula C36H31N5O6 and a molecular weight of 629.67 g/mol. Its IUPAC name is (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-[2-(hydroperoxymethyl)phenyl]-7-[4-(hydroperoxymethyl)phenyl]-4-pyridin-2-ylpyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-[2-(hydroperoxymethyl)phenyl]-7-[4-(hydroperoxymethyl)phenyl]-4-pyridin-2-ylpyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 59956083 |
| Molecular Formula | C36H31N5O6 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-[2-(hydroperoxymethyl)phenyl]-7-[4-(hydroperoxymethyl)phenyl]-4-pyridin-2-ylpyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | CN(C)c1ccc(/C=C/C=c2/c(-c3ccccn3)c3c(n(-c4ccc(COO)cc4)c2=O)=NN(c2ccccc2COO)C3=O)cc1 |
| InChI | InChI=1S/C36H31N5O6/c1-39(2)27-17-13-24(14-18-27)8-7-10-29-32(30-11-5-6-21-37-30)33-34(40(35(29)42)28-19-15-25(16-20-28)22-46-44)38-41(36(33)43)31-12-4-3-9-26(31)23-47-45/h3-21,44-45H,22-23H2,1-2H3/b8-7+,29-10- |
| InChIKey | VUXCWPRVPWWVRV-BZTJCEMQSA-N |
| XLogP | 4.63 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|