C7H7N5 — CID 59956166
(6-methyl-7-methylidenepyrazolo[5,1-c][1,2,4]triazol-3-yl)methanimine (PubChem CID 59956166) has the molecular formula C7H7N5 and a molecular weight of 161.17 g/mol. Its IUPAC name is (6-methyl-7-methylidenepyrazolo[5,1-c][1,2,4]triazol-3-yl)methanimine.
| Compound Name | (6-methyl-7-methylidenepyrazolo[5,1-c][1,2,4]triazol-3-yl)methanimine |
|---|---|
| PubChem CID | 59956166 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (6-methyl-7-methylidenepyrazolo[5,1-c][1,2,4]triazol-3-yl)methanimine |
| SMILES | [H]/N=C/c1nnc2c(=C)c(C)nn12 |
| InChI | InChI=1S/C7H7N5/c1-4-5(2)11-12-6(3-8)9-10-7(4)12/h3,8H,1H2,2H3/b8-3+ |
| InChIKey | HLGYCSRHOLEIJN-FPYGCLRLSA-N |
| XLogP | -0.44 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|