About 2-methylbutane;tungsten
2-methylbutane;tungsten (PubChem CID 59956190) has the molecular formula C5H11W-
and a molecular weight of 254.98 g/mol. Its IUPAC name is 2-methylbutane;tungsten.
Molecular Properties
| Compound Name | 2-methylbutane;tungsten |
| PubChem CID | 59956190 |
| Molecular Formula | C5H11W- |
| Molecular Weight | 254.98 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-methylbutane;tungsten |
| SMILES | [CH2-]CC(C)C.[W] |
| InChI | InChI=1S/C5H11.W/c1-4-5(2)3;/h5H,1,4H2,2-3H3;/q-1; |
| InChIKey | QZIFPSFCUMRCSN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.98 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;tungsten?
The IUPAC name of 2-methylbutane;tungsten (CID 59956190) is 2-methylbutane;tungsten.
What is the SMILES notation for 2-methylbutane;tungsten?
The canonical SMILES for 2-methylbutane;tungsten is [CH2-]CC(C)C.[W].
What is the InChIKey of 2-methylbutane;tungsten?
The InChIKey is QZIFPSFCUMRCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.W/c1-4-5(2)3;/h5H,1,4H2,2-3H3;/q-1;.
What are the key properties of 2-methylbutane;tungsten?
2-methylbutane;tungsten has a molecular weight of 254.98 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;tungsten is sourced from PubChem (CID 59956190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).