C9H16N2 — CID 59956570
(7aS)-4,6-dimethyl-1,2,3,5,7,7a-hexahydropyrrolo[3,4-b]pyridine (PubChem CID 59956570) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (7aS)-4,6-dimethyl-1,2,3,5,7,7a-hexahydropyrrolo[3,4-b]pyridine.
| Compound Name | (7aS)-4,6-dimethyl-1,2,3,5,7,7a-hexahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 59956570 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (7aS)-4,6-dimethyl-1,2,3,5,7,7a-hexahydropyrrolo[3,4-b]pyridine |
| SMILES | CC1=C2CN(C)C[C@H]2NCC1 |
| InChI | InChI=1S/C9H16N2/c1-7-3-4-10-9-6-11(2)5-8(7)9/h9-10H,3-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | ZYYRKOJXRZTDGS-SECBINFHSA-N |
| XLogP | 0.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|