C23H32ClNO2 — CID 59956753
(Z)-6-[(2R,3S)-3-[[(4-chloro-2-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid (PubChem CID 59956753) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is (Z)-6-[(2R,3S)-3-[[(4-chloro-2-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2R,3S)-3-[[(4-chloro-2-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956753 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (Z)-6-[(2R,3S)-3-[[(4-chloro-2-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
| SMILES | Cc1cc(Cl)ccc1CNC[C@H]1C2CCC(CC2)[C@@H]1/C=C\CCCC(=O)O |
| InChI | InChI=1S/C23H32ClNO2/c1-16-13-20(24)12-11-19(16)14-25-15-22-18-9-7-17(8-10-18)21(22)5-3-2-4-6-23(26)27/h3,5,11-13,17-18,21-22,25H,2,4,6-10,14-15H2,1H3,(H,26,27)/b5-3-/t17?,18?,21-,22-/m0/s1 |
| InChIKey | MLHLNNQQANDEIZ-VNXCPOCISA-N |
| XLogP | 5.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|