C10H16 — CID 59956778
(1R,4S,5R,6R)-5,6-dimethylbicyclo[2.2.2]oct-2-ene (PubChem CID 59956778) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (1R,4S,5R,6R)-5,6-dimethylbicyclo[2.2.2]oct-2-ene.
| Compound Name | (1R,4S,5R,6R)-5,6-dimethylbicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 59956778 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (1R,4S,5R,6R)-5,6-dimethylbicyclo[2.2.2]oct-2-ene |
| SMILES | C[C@@H]1[C@@H](C)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C10H16/c1-7-8(2)10-5-3-9(7)4-6-10/h3,5,7-10H,4,6H2,1-2H3/t7-,8-,9-,10+/m1/s1 |
| InChIKey | AAWWHEUMYOUOKG-KYXWUPHJSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|