C23H30FNO2 — CID 59956802
(Z)-6-[(1S,2S,3S,4R)-3-[[(2-fluoro-4-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid (PubChem CID 59956802) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is (Z)-6-[(1S,2S,3S,4R)-3-[[(2-fluoro-4-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1S,2S,3S,4R)-3-[[(2-fluoro-4-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956802 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (Z)-6-[(1S,2S,3S,4R)-3-[[(2-fluoro-4-methylphenyl)methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid |
| SMILES | Cc1ccc(CNC[C@@H]2[C@@H](/C=C\CCCC(=O)O)[C@@H]3C=C[C@H]2CC3)c(F)c1 |
| InChI | InChI=1S/C23H30FNO2/c1-16-7-8-19(22(24)13-16)14-25-15-21-18-11-9-17(10-12-18)20(21)5-3-2-4-6-23(26)27/h3,5,7-9,11,13,17-18,20-21,25H,2,4,6,10,12,14-15H2,1H3,(H,26,27)/b5-3-/t17-,18+,20+,21+/m1/s1 |
| InChIKey | SZIXXQWXFAQCPC-MEUZTUMSSA-N |
| XLogP | 4.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|