C20H25ClFNO2 — CID 59956866
(Z)-6-[(1R,6S)-6-[[(4-chloro-2-fluorophenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid (PubChem CID 59956866) has the molecular formula C20H25ClFNO2 and a molecular weight of 365.88 g/mol. Its IUPAC name is (Z)-6-[(1R,6S)-6-[[(4-chloro-2-fluorophenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,6S)-6-[[(4-chloro-2-fluorophenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956866 |
| Molecular Formula | C20H25ClFNO2 |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (Z)-6-[(1R,6S)-6-[[(4-chloro-2-fluorophenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1CC=CC[C@@H]1CNCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H25ClFNO2/c21-18-11-10-17(19(22)12-18)14-23-13-16-8-5-4-7-15(16)6-2-1-3-9-20(24)25/h2,4-6,10-12,15-16,23H,1,3,7-9,13-14H2,(H,24,25)/b6-2-/t15-,16+/m0/s1 |
| InChIKey | LRKQLZIGVIOBBY-PWHWIJELSA-N |
| XLogP | 4.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|