C14H30N2O — CID 59956883
N-(7-hydroxy-2,3,3,5-tetramethylheptyl)-N'-methylethanimidamide (PubChem CID 59956883) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N-(7-hydroxy-2,3,3,5-tetramethylheptyl)-N'-methylethanimidamide.
| Compound Name | N-(7-hydroxy-2,3,3,5-tetramethylheptyl)-N'-methylethanimidamide |
|---|---|
| PubChem CID | 59956883 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N-(7-hydroxy-2,3,3,5-tetramethylheptyl)-N'-methylethanimidamide |
| SMILES | C/N=C(\C)NCC(C)C(C)(C)CC(C)CCO |
| InChI | InChI=1S/C14H30N2O/c1-11(7-8-17)9-14(4,5)12(2)10-16-13(3)15-6/h11-12,17H,7-10H2,1-6H3,(H,15,16) |
| InChIKey | NMPUSYOZSVDDLW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|