About 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium
3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium (PubChem CID 59957086) has the molecular formula C6H8NO2Y-
and a molecular weight of 215.04 g/mol. Its IUPAC name is 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium.
Molecular Properties
| Compound Name | 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium |
| PubChem CID | 59957086 |
| Molecular Formula | C6H8NO2Y- |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium |
| SMILES | CC1C(=O)[N-]C(=O)C1C.[Y] |
| InChI | InChI=1S/C6H9NO2.Y/c1-3-4(2)6(9)7-5(3)8;/h3-4H,1-2H3,(H,7,8,9);/p-1 |
| InChIKey | QXPQXUSMPDUNCI-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium?
The IUPAC name of 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium (CID 59957086) is 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium.
What is the SMILES notation for 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium?
The canonical SMILES for 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium is CC1C(=O)[N-]C(=O)C1C.[Y].
What is the InChIKey of 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium?
The InChIKey is QXPQXUSMPDUNCI-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9NO2.Y/c1-3-4(2)6(9)7-5(3)8;/h3-4H,1-2H3,(H,7,8,9);/p-1.
What are the key properties of 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium?
3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium has a molecular weight of 215.04 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium is sourced from PubChem (CID 59957086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).