C6H8NO2Y- — CID 59957086
3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium (PubChem CID 59957086) has the molecular formula C6H8NO2Y- and a molecular weight of 215.04 g/mol. Its IUPAC name is 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium.
| Compound Name | 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium |
|---|---|
| PubChem CID | 59957086 |
| Molecular Formula | C6H8NO2Y- |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 3,4-dimethylpyrrolidin-1-ide-2,5-dione;yttrium |
| SMILES | CC1C(=O)[N-]C(=O)C1C.[Y] |
| InChI | InChI=1S/C6H9NO2.Y/c1-3-4(2)6(9)7-5(3)8;/h3-4H,1-2H3,(H,7,8,9);/p-1 |
| InChIKey | QXPQXUSMPDUNCI-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|