C16H21N3O7S — CID 59957308
2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 59957308) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 59957308 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)CC(CN2C(=O)NC(C)(C)C2=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C16H21N3O7S/c1-16(2)14(21)19(15(22)17-16)8-10(13(20)18-23)9-27(24,25)12-6-4-11(26-3)5-7-12/h4-7,10,23H,8-9H2,1-3H3,(H,17,22)(H,18,20) |
| InChIKey | KXQQYPHHZTXPDE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|