C7H13N — CID 59957396
N-ethyl-3-methylbuta-1,3-dien-1-amine (PubChem CID 59957396) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is N-ethyl-3-methylbuta-1,3-dien-1-amine.
| Compound Name | N-ethyl-3-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 59957396 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N-ethyl-3-methylbuta-1,3-dien-1-amine |
| SMILES | C=C(C)C=CNCC |
| InChI | InChI=1S/C7H13N/c1-4-8-6-5-7(2)3/h5-6,8H,2,4H2,1,3H3 |
| InChIKey | NIYPYVWROOMEMB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|